C19H18BrN5O3 — CID 55976892
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 55976892) has the molecular formula C19H18BrN5O3 and a molecular weight of 444.29 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55976892 |
| Molecular Formula | C19H18BrN5O3 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCc1cn2cc(Br)ccc2n1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18BrN5O3/c20-14-4-6-18-22-15(12-24(18)11-14)10-21-19(26)13-3-5-16(17(9-13)25(27)28)23-7-1-2-8-23/h3-6,9,11-12H,1-2,7-8,10H2,(H,21,26) |
| InChIKey | AQHCBVQTRAVVAT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|