C21H23ClN6O3 — CID 133344893
4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1,4-diazepan-1-yl]-N-methyl-3-nitrobenzamide (PubChem CID 133344893) has the molecular formula C21H23ClN6O3 and a molecular weight of 442.91 g/mol. Its IUPAC name is 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1,4-diazepan-1-yl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1,4-diazepan-1-yl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133344893 |
| Molecular Formula | C21H23ClN6O3 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-[4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-1,4-diazepan-1-yl]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(N2CCCN(Cc3cn4cc(Cl)ccc4n3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23ClN6O3/c1-23-21(29)15-3-5-18(19(11-15)28(30)31)26-8-2-7-25(9-10-26)13-17-14-27-12-16(22)4-6-20(27)24-17/h3-6,11-12,14H,2,7-10,13H2,1H3,(H,23,29) |
| InChIKey | JIFFKDUGXWCJDH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|