C18H23N5O3S — CID 133272989
4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-N-methyl-3-nitrobenzamide (PubChem CID 133272989) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133272989 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-N-methyl-3-nitrobenzamide |
| SMILES | CCc1nc(CN2CCN(c3ccc(C(=O)NC)cc3[N+](=O)[O-])CC2)cs1 |
| InChI | InChI=1S/C18H23N5O3S/c1-3-17-20-14(12-27-17)11-21-6-8-22(9-7-21)15-5-4-13(18(24)19-2)10-16(15)23(25)26/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,19,24) |
| InChIKey | XVUIQFQFXLXYBV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|