C17H19N5O2S — CID 133272917
2-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-nitrobenzonitrile (PubChem CID 133272917) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-nitrobenzonitrile.
| Compound Name | 2-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 133272917 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-5-nitrobenzonitrile |
| SMILES | CCc1nc(CN2CCN(c3ccc([N+](=O)[O-])cc3C#N)CC2)cs1 |
| InChI | InChI=1S/C17H19N5O2S/c1-2-17-19-14(12-25-17)11-20-5-7-21(8-6-20)16-4-3-15(22(23)24)9-13(16)10-18/h3-4,9,12H,2,5-8,11H2,1H3 |
| InChIKey | CXESCVWLQPFFIT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|