C16H21N3O2 — CID 115501196
2-(4,4-diethylpiperidin-1-yl)-5-nitrobenzonitrile (PubChem CID 115501196) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(4,4-diethylpiperidin-1-yl)-5-nitrobenzonitrile.
| Compound Name | 2-(4,4-diethylpiperidin-1-yl)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 115501196 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-(4,4-diethylpiperidin-1-yl)-5-nitrobenzonitrile |
| SMILES | CCC1(CC)CCN(c2ccc([N+](=O)[O-])cc2C#N)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-16(4-2)7-9-18(10-8-16)15-6-5-14(19(20)21)11-13(15)12-17/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | HZXKRHSMMQDMIG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|