C14H18N4O2 — CID 115501219
5-nitro-2-(3,3,4-trimethylpiperazin-1-yl)benzonitrile (PubChem CID 115501219) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-nitro-2-(3,3,4-trimethylpiperazin-1-yl)benzonitrile.
| Compound Name | 5-nitro-2-(3,3,4-trimethylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115501219 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-nitro-2-(3,3,4-trimethylpiperazin-1-yl)benzonitrile |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2C#N)CC1(C)C |
| InChI | InChI=1S/C14H18N4O2/c1-14(2)10-17(7-6-16(14)3)13-5-4-12(18(19)20)8-11(13)9-15/h4-5,8H,6-7,10H2,1-3H3 |
| InChIKey | QPMQFNUBVDWQHF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|