C12H13N3O2S — CID 51081398
5-nitro-2-(1,4-thiazepan-4-yl)benzonitrile (PubChem CID 51081398) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 5-nitro-2-(1,4-thiazepan-4-yl)benzonitrile.
| Compound Name | 5-nitro-2-(1,4-thiazepan-4-yl)benzonitrile |
|---|---|
| PubChem CID | 51081398 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-nitro-2-(1,4-thiazepan-4-yl)benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCCSCC1 |
| InChI | InChI=1S/C12H13N3O2S/c13-9-10-8-11(15(16)17)2-3-12(10)14-4-1-6-18-7-5-14/h2-3,8H,1,4-7H2 |
| InChIKey | TYHJBUCGOHKXCN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|