C20H29N5O4S2 — CID 55531079
N,N-diethyl-4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 55531079) has the molecular formula C20H29N5O4S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55531079 |
| Molecular Formula | C20H29N5O4S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N,N-diethyl-4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CCc1nc(CN2CCN(c3ccc(S(=O)(=O)N(CC)CC)cc3[N+](=O)[O-])CC2)cs1 |
| InChI | InChI=1S/C20H29N5O4S2/c1-4-20-21-16(15-30-20)14-22-9-11-23(12-10-22)18-8-7-17(13-19(18)25(26)27)31(28,29)24(5-2)6-3/h7-8,13,15H,4-6,9-12,14H2,1-3H3 |
| InChIKey | SCFKTBHNIXROOK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|