C17H26N4O6S — CID 46797953
ethyl 4-[4-(diethylsulfamoyl)-2-nitrophenyl]piperazine-1-carboxylate (PubChem CID 46797953) has the molecular formula C17H26N4O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is ethyl 4-[4-(diethylsulfamoyl)-2-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(diethylsulfamoyl)-2-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46797953 |
| Molecular Formula | C17H26N4O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | ethyl 4-[4-(diethylsulfamoyl)-2-nitrophenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(S(=O)(=O)N(CC)CC)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26N4O6S/c1-4-20(5-2)28(25,26)14-7-8-15(16(13-14)21(23)24)18-9-11-19(12-10-18)17(22)27-6-3/h7-8,13H,4-6,9-12H2,1-3H3 |
| InChIKey | AUTOCCCXDNSAPX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|