C20H26N4O6S2 — CID 26943074
4-[4-(benzenesulfonyl)piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 26943074) has the molecular formula C20H26N4O6S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26943074 |
| Molecular Formula | C20H26N4O6S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(S(=O)(=O)c3ccccc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N4O6S2/c1-3-22(4-2)32(29,30)18-10-11-19(20(16-18)24(25)26)21-12-14-23(15-13-21)31(27,28)17-8-6-5-7-9-17/h5-11,16H,3-4,12-15H2,1-2H3 |
| InChIKey | CJRFFNIGKCKPNL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|