C22H29FN4O5S — CID 32698290
N,N-diethyl-4-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 32698290) has the molecular formula C22H29FN4O5S and a molecular weight of 480.56 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 32698290 |
| Molecular Formula | C22H29FN4O5S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N,N-diethyl-4-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(Cc3cc(F)ccc3OC)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H29FN4O5S/c1-4-26(5-2)33(30,31)19-7-8-20(21(15-19)27(28)29)25-12-10-24(11-13-25)16-17-14-18(23)6-9-22(17)32-3/h6-9,14-15H,4-5,10-13,16H2,1-3H3 |
| InChIKey | ZRXDNENCMAPTNV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|