C16H17N5O2S — CID 133276252
5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 133276252) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133276252 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CCCN(Cc2cscn2)CC1 |
| InChI | InChI=1S/C16H17N5O2S/c17-9-13-8-15(21(22)23)2-3-16(13)20-5-1-4-19(6-7-20)10-14-11-24-12-18-14/h2-3,8,11-12H,1,4-7,10H2 |
| InChIKey | MDPMXCLGHWUCIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|