C16H16ClF3N4O2S — CID 133276236
4-[[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]methyl]-1,3-thiazole (PubChem CID 133276236) has the molecular formula C16H16ClF3N4O2S and a molecular weight of 420.84 g/mol. Its IUPAC name is 4-[[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 133276236 |
| Molecular Formula | C16H16ClF3N4O2S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-[[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]methyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)cc1N1CCCN(Cc2cscn2)CC1 |
| InChI | InChI=1S/C16H16ClF3N4O2S/c17-13-7-14(15(24(25)26)6-12(13)16(18,19)20)23-3-1-2-22(4-5-23)8-11-9-27-10-21-11/h6-7,9-10H,1-5,8H2 |
| InChIKey | AETKMBGHNDFFPS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|