C13H14ClF3N4O3 — CID 52864203
4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 52864203) has the molecular formula C13H14ClF3N4O3 and a molecular weight of 366.73 g/mol. Its IUPAC name is 4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 52864203 |
| Molecular Formula | C13H14ClF3N4O3 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(c2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H14ClF3N4O3/c14-9-7-10(11(21(23)24)6-8(9)13(15,16)17)19-2-1-3-20(5-4-19)12(18)22/h6-7H,1-5H2,(H2,18,22) |
| InChIKey | UCSRJXGUEGASGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|