About 1-(5-chloro-2,4-dinitrophenyl)azepane
1-(5-chloro-2,4-dinitrophenyl)azepane (PubChem CID 2842391) has the molecular formula C12H14ClN3O4
and a molecular weight of 299.71 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dinitrophenyl)azepane.
Molecular Properties
| Compound Name | 1-(5-chloro-2,4-dinitrophenyl)azepane |
| PubChem CID | 2842391 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(5-chloro-2,4-dinitrophenyl)azepane |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCCCCC2)cc1Cl |
| InChI | InChI=1S/C12H14ClN3O4/c13-9-7-11(14-5-3-1-2-4-6-14)12(16(19)20)8-10(9)15(17)18/h7-8H,1-6H2 |
| InChIKey | WAGTVSNZJBOBOS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-2,4-dinitrophenyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2,4-dinitrophenyl)azepane?
The IUPAC name of 1-(5-chloro-2,4-dinitrophenyl)azepane (CID 2842391) is 1-(5-chloro-2,4-dinitrophenyl)azepane.
What is the SMILES notation for 1-(5-chloro-2,4-dinitrophenyl)azepane?
The canonical SMILES for 1-(5-chloro-2,4-dinitrophenyl)azepane is O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCCCCC2)cc1Cl.
What is the InChIKey of 1-(5-chloro-2,4-dinitrophenyl)azepane?
The InChIKey is WAGTVSNZJBOBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O4/c13-9-7-11(14-5-3-1-2-4-6-14)12(16(19)20)8-10(9)15(17)18/h7-8H,1-6H2.
What are the key properties of 1-(5-chloro-2,4-dinitrophenyl)azepane?
1-(5-chloro-2,4-dinitrophenyl)azepane has a molecular weight of 299.71 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2,4-dinitrophenyl)azepane is sourced from PubChem (CID 2842391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).