C11H12N2O4 — CID 39732315
1-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine (PubChem CID 39732315) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine.
| Compound Name | 1-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine |
|---|---|
| PubChem CID | 39732315 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidine |
| SMILES | O=[N+]([O-])c1cc2c(cc1N1CCCC1)OCO2 |
| InChI | InChI=1S/C11H12N2O4/c14-13(15)9-6-11-10(16-7-17-11)5-8(9)12-3-1-2-4-12/h5-6H,1-4,7H2 |
| InChIKey | RZZZTHQIJSUCLN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|