About 1-(5-azido-2,4-dinitrophenyl)piperidine
1-(5-azido-2,4-dinitrophenyl)piperidine (PubChem CID 169326393) has the molecular formula C11H12N6O4
and a molecular weight of 292.25 g/mol. Its IUPAC name is 1-(5-azido-2,4-dinitrophenyl)piperidine.
Molecular Properties
| Compound Name | 1-(5-azido-2,4-dinitrophenyl)piperidine |
| PubChem CID | 169326393 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(5-azido-2,4-dinitrophenyl)piperidine |
| SMILES | [N-]=[N+]=Nc1cc(N2CCCCC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N6O4/c12-14-13-8-6-10(15-4-2-1-3-5-15)11(17(20)21)7-9(8)16(18)19/h6-7H,1-5H2 |
| InChIKey | BTGAGYZZZVRWSK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-azido-2,4-dinitrophenyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-azido-2,4-dinitrophenyl)piperidine?
The IUPAC name of 1-(5-azido-2,4-dinitrophenyl)piperidine (CID 169326393) is 1-(5-azido-2,4-dinitrophenyl)piperidine.
What is the SMILES notation for 1-(5-azido-2,4-dinitrophenyl)piperidine?
The canonical SMILES for 1-(5-azido-2,4-dinitrophenyl)piperidine is [N-]=[N+]=Nc1cc(N2CCCCC2)c([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 1-(5-azido-2,4-dinitrophenyl)piperidine?
The InChIKey is BTGAGYZZZVRWSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6O4/c12-14-13-8-6-10(15-4-2-1-3-5-15)11(17(20)21)7-9(8)16(18)19/h6-7H,1-5H2.
What are the key properties of 1-(5-azido-2,4-dinitrophenyl)piperidine?
1-(5-azido-2,4-dinitrophenyl)piperidine has a molecular weight of 292.25 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-azido-2,4-dinitrophenyl)piperidine is sourced from PubChem (CID 169326393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).