About 4-azido-5-nitrobenzene-1,2-dicarbonitrile
4-azido-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 152630324) has the molecular formula C8H2N6O2
and a molecular weight of 214.14 g/mol. Its IUPAC name is 4-azido-5-nitrobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-azido-5-nitrobenzene-1,2-dicarbonitrile |
| PubChem CID | 152630324 |
| Molecular Formula | C8H2N6O2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 4-azido-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(N=[N+]=[N-])c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C8H2N6O2/c9-3-5-1-7(12-13-11)8(14(15)16)2-6(5)4-10/h1-2H |
| InChIKey | ZDJUHKBMUXQYPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 139.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-5-nitrobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-5-nitrobenzene-1,2-dicarbonitrile?
The IUPAC name of 4-azido-5-nitrobenzene-1,2-dicarbonitrile (CID 152630324) is 4-azido-5-nitrobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-azido-5-nitrobenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-azido-5-nitrobenzene-1,2-dicarbonitrile is N#Cc1cc(N=[N+]=[N-])c([N+](=O)[O-])cc1C#N.
What is the InChIKey of 4-azido-5-nitrobenzene-1,2-dicarbonitrile?
The InChIKey is ZDJUHKBMUXQYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2N6O2/c9-3-5-1-7(12-13-11)8(14(15)16)2-6(5)4-10/h1-2H.
What are the key properties of 4-azido-5-nitrobenzene-1,2-dicarbonitrile?
4-azido-5-nitrobenzene-1,2-dicarbonitrile has a molecular weight of 214.14 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-5-nitrobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 152630324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).