C9H8N4O4 — CID 15711330
8-azido-7-nitro-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 15711330) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is 8-azido-7-nitro-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 8-azido-7-nitro-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 15711330 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 8-azido-7-nitro-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | [N-]=[N+]=Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C9H8N4O4/c10-12-11-6-4-8-9(5-7(6)13(14)15)17-3-1-2-16-8/h4-5H,1-3H2 |
| InChIKey | BAEUHHFGPISHQU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|