About (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea
(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea (PubChem CID 169358518) has the molecular formula C10H11N3O4S
and a molecular weight of 269.28 g/mol. Its IUPAC name is (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea.
Molecular Properties
| Compound Name | (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea |
| PubChem CID | 169358518 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea |
| SMILES | NC(=S)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C10H11N3O4S/c11-10(18)12-6-4-8-9(5-7(6)13(14)15)17-3-1-2-16-8/h4-5H,1-3H2,(H3,11,12,18) |
| InChIKey | DBELPJLKODZNCP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea?
The IUPAC name of (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea (CID 169358518) is (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea.
What is the SMILES notation for (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea?
The canonical SMILES for (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea is NC(=S)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2.
What is the InChIKey of (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea?
The InChIKey is DBELPJLKODZNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O4S/c11-10(18)12-6-4-8-9(5-7(6)13(14)15)17-3-1-2-16-8/h4-5H,1-3H2,(H3,11,12,18).
What are the key properties of (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea?
(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea has a molecular weight of 269.28 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)thiourea is sourced from PubChem (CID 169358518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).