C21H23N3O9 — CID 25332958
methyl 4,5-dimethoxy-2-[[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl]amino]benzoate (PubChem CID 25332958) has the molecular formula C21H23N3O9 and a molecular weight of 461.43 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-2-[[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4,5-dimethoxy-2-[[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 25332958 |
| Molecular Formula | C21H23N3O9 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 4,5-dimethoxy-2-[[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NCC(=O)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C21H23N3O9/c1-29-16-7-12(21(26)31-3)13(8-17(16)30-2)22-11-20(25)23-14-9-18-19(10-15(14)24(27)28)33-6-4-5-32-18/h7-10,22H,4-6,11H2,1-3H3,(H,23,25) |
| InChIKey | XOEZQURNONHKFN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 147.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|