C21H18N2O7S — CID 42038893
[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 42038893) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 42038893 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2cc3c(cc2[N+](=O)[O-])OCCCO3)sc2ccccc12 |
| InChI | InChI=1S/C21H18N2O7S/c1-12-13-5-2-3-6-18(13)31-20(12)21(25)30-11-19(24)22-14-9-16-17(10-15(14)23(26)27)29-8-4-7-28-16/h2-3,5-6,9-10H,4,7-8,11H2,1H3,(H,22,24) |
| InChIKey | ULCKMOFBEUEPAD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|