C17H20N2O8 — CID 36637647
[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] oxane-4-carboxylate (PubChem CID 36637647) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] oxane-4-carboxylate.
| Compound Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] oxane-4-carboxylate |
|---|---|
| PubChem CID | 36637647 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] oxane-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCOCC1)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C17H20N2O8/c20-16(10-27-17(21)11-2-6-24-7-3-11)18-12-8-14-15(9-13(12)19(22)23)26-5-1-4-25-14/h8-9,11H,1-7,10H2,(H,18,20) |
| InChIKey | IJIFEPIBHPUJMC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|