C22H19N3O9 — CID 46668667
[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46668667) has the molecular formula C22H19N3O9 and a molecular weight of 469.41 g/mol. Its IUPAC name is [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46668667 |
| Molecular Formula | C22H19N3O9 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19N3O9/c1-12(24-20(27)13-5-2-3-6-14(13)21(24)28)22(29)34-11-19(26)23-15-9-17-18(10-16(15)25(30)31)33-8-4-7-32-17/h2-3,5-6,9-10,12H,4,7-8,11H2,1H3,(H,23,26) |
| InChIKey | LAYXFVKWXHXQEK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|