C19H23N3O8 — CID 41163272
[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 41163272) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 41163272 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCCCCC1=O)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C19H23N3O8/c23-17(12-30-19(25)11-21-6-3-1-2-5-18(21)24)20-13-9-15-16(10-14(13)22(26)27)29-8-4-7-28-15/h9-10H,1-8,11-12H2,(H,20,23) |
| InChIKey | VVIGADNITUWKGO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|