C22H23N3O8 — CID 42321727
[2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate (PubChem CID 42321727) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate.
| Compound Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42321727 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-2-oxoethyl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCC(=O)Nc2cc3c(cc2[N+](=O)[O-])OCCCO3)cc1C |
| InChI | InChI=1S/C22H23N3O8/c1-13-4-5-15(8-14(13)2)22(28)23-11-21(27)33-12-20(26)24-16-9-18-19(10-17(16)25(29)30)32-7-3-6-31-18/h4-5,8-10H,3,6-7,11-12H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | AYSXCVDBJMPKOU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|