C23H27N3O7 — CID 4639418
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 4639418) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4639418 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | COc1cc(NC(=O)COC(=O)CNC(=O)c2ccc(C(C)(C)C)cc2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N3O7/c1-14-10-18(26(30)31)19(32-5)11-17(14)25-20(27)13-33-21(28)12-24-22(29)15-6-8-16(9-7-15)23(2,3)4/h6-11H,12-13H2,1-5H3,(H,24,29)(H,25,27) |
| InChIKey | JKOZAFHSOZOZBJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|