C23H26N2O8 — CID 4315208
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 4-oxo-4-(4-propoxyphenyl)butanoate (PubChem CID 4315208) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 4-oxo-4-(4-propoxyphenyl)butanoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 4-oxo-4-(4-propoxyphenyl)butanoate |
|---|---|
| PubChem CID | 4315208 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 4-oxo-4-(4-propoxyphenyl)butanoate |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc(OC)c([N+](=O)[O-])cc2C)cc1 |
| InChI | InChI=1S/C23H26N2O8/c1-4-11-32-17-7-5-16(6-8-17)20(26)9-10-23(28)33-14-22(27)24-18-13-21(31-3)19(25(29)30)12-15(18)2/h5-8,12-13H,4,9-11,14H2,1-3H3,(H,24,27) |
| InChIKey | MHXXRXYCZWWPNM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|