C20H19ClN2O6 — CID 7750973
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 7750973) has the molecular formula C20H19ClN2O6 and a molecular weight of 418.83 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7750973 |
| Molecular Formula | C20H19ClN2O6 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)CCC(=O)c2ccc(Cl)cc2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C20H19ClN2O6/c1-12-9-16(17(23(27)28)10-13(12)2)22-19(25)11-29-20(26)8-7-18(24)14-3-5-15(21)6-4-14/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,25) |
| InChIKey | AOFZVRKWTONNPS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|