C14H16N2O5 — CID 95607747
trans-(1R,2R)-2-methyl-N-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)cyclopropane-1-carboxamide (PubChem CID 95607747) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is trans-(1R,2R)-2-methyl-N-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-methyl-N-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95607747 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | trans-(1R,2R)-2-methyl-N-(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)cyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C14H16N2O5/c1-8-5-9(8)14(17)15-10-6-12-13(7-11(10)16(18)19)21-4-2-3-20-12/h6-9H,2-5H2,1H3,(H,15,17)/t8-,9-/m1/s1 |
| InChIKey | JUTGGTMJECHZRV-RKDXNWHRSA-N |
| XLogP | 2.35 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|