C12H12N2O5 — CID 73010637
N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)but-2-enamide (PubChem CID 73010637) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)but-2-enamide.
| Compound Name | N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 73010637 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)but-2-enamide |
| SMILES | CC=CC(=O)Nc1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C12H12N2O5/c1-2-3-12(15)13-8-6-10-11(19-5-4-18-10)7-9(8)14(16)17/h2-3,6-7H,4-5H2,1H3,(H,13,15) |
| InChIKey | MZENEQJVGAIXEM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|