C10H9NO5 — CID 2754504
1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone (PubChem CID 2754504) has the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone.
| Compound Name | 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone |
|---|---|
| PubChem CID | 2754504 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone |
| SMILES | CC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C10H9NO5/c1-6(12)7-4-9-10(16-3-2-15-9)5-8(7)11(13)14/h4-5H,2-3H2,1H3 |
| InChIKey | ZPHONNSYOVXZDJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|