C12H12N2O7 — CID 119225671
2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanoic acid (PubChem CID 119225671) has the molecular formula C12H12N2O7 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119225671 |
| Molecular Formula | C12H12N2O7 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C(=O)O |
| InChI | InChI=1S/C12H12N2O7/c1-6(12(16)17)13-11(15)7-4-9-10(21-3-2-20-9)5-8(7)14(18)19/h4-6H,2-3H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | KIJDOKPYXPHLHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|