C19H18N2O7 — CID 120541103
2-methyl-3-[4-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]phenyl]propanoic acid (PubChem CID 120541103) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2-methyl-3-[4-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | 2-methyl-3-[4-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120541103 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-methyl-3-[4-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]phenyl]propanoic acid |
| SMILES | CC(Cc1ccc(NC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)cc1)C(=O)O |
| InChI | InChI=1S/C19H18N2O7/c1-11(19(23)24)8-12-2-4-13(5-3-12)20-18(22)14-9-16-17(28-7-6-27-16)10-15(14)21(25)26/h2-5,9-11H,6-8H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | FJNHWZPMCGHDLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|