C23H19N3O7 — CID 55901067
N-[3-(2-anilino-2-oxoethoxy)phenyl]-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 55901067) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethoxy)phenyl]-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 55901067 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethoxy)phenyl]-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)c1)Nc1ccccc1 |
| InChI | InChI=1S/C23H19N3O7/c27-22(24-15-5-2-1-3-6-15)14-33-17-8-4-7-16(11-17)25-23(28)18-12-20-21(32-10-9-31-20)13-19(18)26(29)30/h1-8,11-13H,9-10,14H2,(H,24,27)(H,25,28) |
| InChIKey | JFWVKQQOJAATLQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|