C24H21N3O8 — CID 24538860
6-nitro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide (PubChem CID 24538860) has the molecular formula C24H21N3O8 and a molecular weight of 479.45 g/mol. Its IUPAC name is 6-nitro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide.
| Compound Name | 6-nitro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
|---|---|
| PubChem CID | 24538860 |
| Molecular Formula | C24H21N3O8 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 6-nitro-N'-[2-(4-phenylmethoxyphenoxy)acetyl]-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NNC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C24H21N3O8/c28-23(15-35-18-8-6-17(7-9-18)34-14-16-4-2-1-3-5-16)25-26-24(29)19-12-21-22(33-11-10-32-21)13-20(19)27(30)31/h1-9,12-13H,10-11,14-15H2,(H,25,28)(H,26,29) |
| InChIKey | UBBWJINCBKPHSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|