C21H25N3O8 — CID 34871494
N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 34871494) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 34871494 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[3-[2-(ethylamino)-2-oxoethoxy]phenyl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | CCNC(=O)COc1cccc(NC(=O)c2cc(OC)c(OCCOC)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N3O8/c1-4-22-20(25)13-32-15-7-5-6-14(10-15)23-21(26)16-11-18(30-3)19(31-9-8-29-2)12-17(16)24(27)28/h5-7,10-12H,4,8-9,13H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | GDBKDYHASZLIPV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|