C17H18N2O7S — CID 26975903
5-ethoxy-4-methoxy-N-(3-methylsulfonylphenyl)-2-nitrobenzamide (PubChem CID 26975903) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 5-ethoxy-4-methoxy-N-(3-methylsulfonylphenyl)-2-nitrobenzamide.
| Compound Name | 5-ethoxy-4-methoxy-N-(3-methylsulfonylphenyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 26975903 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-ethoxy-4-methoxy-N-(3-methylsulfonylphenyl)-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(S(C)(=O)=O)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H18N2O7S/c1-4-26-16-9-13(14(19(21)22)10-15(16)25-2)17(20)18-11-6-5-7-12(8-11)27(3,23)24/h5-10H,4H2,1-3H3,(H,18,20) |
| InChIKey | CEKOQWUCUGOFAN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|