C18H17N3O7 — CID 55846187
methyl N-[4-[[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]methyl]phenyl]carbamate (PubChem CID 55846187) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is methyl N-[4-[[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55846187 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl N-[4-[[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)cc1 |
| InChI | InChI=1S/C18H17N3O7/c1-26-18(23)20-12-4-2-11(3-5-12)10-19-17(22)13-8-15-16(28-7-6-27-15)9-14(13)21(24)25/h2-5,8-9H,6-7,10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | IDFGJVFUYVWIEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|