C21H15FN2O6 — CID 24641576
N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide (PubChem CID 24641576) has the molecular formula C21H15FN2O6 and a molecular weight of 410.36 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 24641576 |
| Molecular Formula | C21H15FN2O6 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-nitro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)cc1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C21H15FN2O6/c22-14-3-7-16(8-4-14)30-15-5-1-13(2-6-15)11-23-21(25)17-9-19-20(29-12-28-19)10-18(17)24(26)27/h1-10H,11-12H2,(H,23,25) |
| InChIKey | DAYBWFJYMPLYBH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|