C8H4NO6- — CID 6994262
6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 6994262) has the molecular formula C8H4NO6- and a molecular weight of 210.12 g/mol. Its IUPAC name is 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 6994262 |
| Molecular Formula | C8H4NO6- |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C([O-])c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C8H5NO6/c10-8(11)4-1-6-7(15-3-14-6)2-5(4)9(12)13/h1-2H,3H2,(H,10,11)/p-1 |
| InChIKey | XQJWBDDLVCMLAB-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|