C8H5N2O6- — CID 3671899
5-methyl-2,4-dinitrobenzoate (PubChem CID 3671899) has the molecular formula C8H5N2O6- and a molecular weight of 225.14 g/mol. Its IUPAC name is 5-methyl-2,4-dinitrobenzoate.
| Compound Name | 5-methyl-2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 3671899 |
| Molecular Formula | C8H5N2O6- |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 5-methyl-2,4-dinitrobenzoate |
| SMILES | Cc1cc(C(=O)[O-])c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N2O6/c1-4-2-5(8(11)12)7(10(15)16)3-6(4)9(13)14/h2-3H,1H3,(H,11,12)/p-1 |
| InChIKey | SESSPRSOEAVOMC-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|