C13H13NO5 — CID 177352316
cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methanone (PubChem CID 177352316) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methanone.
| Compound Name | cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 177352316 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | cyclopentyl-(6-nitro-1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1cc2c(cc1[N+](=O)[O-])OCO2)C1CCCC1 |
| InChI | InChI=1S/C13H13NO5/c15-13(8-3-1-2-4-8)9-5-11-12(19-7-18-11)6-10(9)14(16)17/h5-6,8H,1-4,7H2 |
| InChIKey | TYYJTACIFXOZKU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|