6-nitro-1,3-benzodioxole-5-carbonyl chloride

C8H4ClNO5 — CID 15563894

IUPAC6-nitro-1,3-benzodioxole-5-carbonyl chloride
SMILESO=C(Cl)c1cc2c(cc1[N+](=O)[O-])OCO2
InChIInChI=1S/C8H4ClNO5/c9-8(11)4-1-6-7(15-3-14-6)2-5(4)10(12)13/h1-2H,3H2
InChIKeyZOVGDBZRBILXPG-UHFFFAOYSA-N
MW229.57 g/mol
LogP1.70
Rot. Bonds2

About 6-nitro-1,3-benzodioxole-5-carbonyl chloride

6-nitro-1,3-benzodioxole-5-carbonyl chloride (PubChem CID 15563894) has the molecular formula C8H4ClNO5 and a molecular weight of 229.57 g/mol. Its IUPAC name is 6-nitro-1,3-benzodioxole-5-carbonyl chloride.

Molecular Properties

Compound Name6-nitro-1,3-benzodioxole-5-carbonyl chloride
PubChem CID15563894
Molecular FormulaC8H4ClNO5
Molecular Weight229.57 g/mol
Exact Mass228.98
IUPAC Name6-nitro-1,3-benzodioxole-5-carbonyl chloride
SMILESO=C(Cl)c1cc2c(cc1[N+](=O)[O-])OCO2
InChIInChI=1S/C8H4ClNO5/c9-8(11)4-1-6-7(15-3-14-6)2-5(4)10(12)13/h1-2H,3H2
InChIKeyZOVGDBZRBILXPG-UHFFFAOYSA-N
XLogP1.70
TPSA78.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.57
LogP ≤ 51.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-nitro-1,3-benzodioxole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-nitro-1,3-benzodioxole-5-carbonyl chloride?
The IUPAC name of 6-nitro-1,3-benzodioxole-5-carbonyl chloride (CID 15563894) is 6-nitro-1,3-benzodioxole-5-carbonyl chloride.
What is the SMILES notation for 6-nitro-1,3-benzodioxole-5-carbonyl chloride?
The canonical SMILES for 6-nitro-1,3-benzodioxole-5-carbonyl chloride is O=C(Cl)c1cc2c(cc1[N+](=O)[O-])OCO2.
What is the InChIKey of 6-nitro-1,3-benzodioxole-5-carbonyl chloride?
The InChIKey is ZOVGDBZRBILXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNO5/c9-8(11)4-1-6-7(15-3-14-6)2-5(4)10(12)13/h1-2H,3H2.
What are the key properties of 6-nitro-1,3-benzodioxole-5-carbonyl chloride?
6-nitro-1,3-benzodioxole-5-carbonyl chloride has a molecular weight of 229.57 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1,3-benzodioxole-5-carbonyl chloride is sourced from PubChem (CID 15563894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).