C8H4ClNO5 — CID 15563894
6-nitro-1,3-benzodioxole-5-carbonyl chloride (PubChem CID 15563894) has the molecular formula C8H4ClNO5 and a molecular weight of 229.57 g/mol. Its IUPAC name is 6-nitro-1,3-benzodioxole-5-carbonyl chloride.
| Compound Name | 6-nitro-1,3-benzodioxole-5-carbonyl chloride |
|---|---|
| PubChem CID | 15563894 |
| Molecular Formula | C8H4ClNO5 |
| Molecular Weight | 229.57 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 6-nitro-1,3-benzodioxole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C8H4ClNO5/c9-8(11)4-1-6-7(15-3-14-6)2-5(4)10(12)13/h1-2H,3H2 |
| InChIKey | ZOVGDBZRBILXPG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|