C21H23NO7 — CID 39952628
[(2S)-1-(1-adamantyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 39952628) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 39952628 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [(2S)-1-(1-adamantyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23NO7/c1-11(19(23)21-7-12-2-13(8-21)4-14(3-12)9-21)29-20(24)15-5-17-18(28-10-27-17)6-16(15)22(25)26/h5-6,11-14H,2-4,7-10H2,1H3/t11-,12?,13?,14?,21?/m0/s1 |
| InChIKey | YCRHCLDQPACSEE-OWFXSXJRSA-N |
| XLogP | 3.65 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|