C12H15NO4 — CID 20811673
5-(2,2-dimethylpropyl)-6-nitro-1,3-benzodioxole (PubChem CID 20811673) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-6-nitro-1,3-benzodioxole.
| Compound Name | 5-(2,2-dimethylpropyl)-6-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 20811673 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-6-nitro-1,3-benzodioxole |
| SMILES | CC(C)(C)Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-12(2,3)6-8-4-10-11(17-7-16-10)5-9(8)13(14)15/h4-5H,6-7H2,1-3H3 |
| InChIKey | SDCVPUOUFXNHAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|