C11H14N2O6 — CID 63697755
N-(2,2-dimethoxyethyl)-6-nitro-1,3-benzodioxol-5-amine (PubChem CID 63697755) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-6-nitro-1,3-benzodioxol-5-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-6-nitro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63697755 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-6-nitro-1,3-benzodioxol-5-amine |
| SMILES | COC(CNc1cc2c(cc1[N+](=O)[O-])OCO2)OC |
| InChI | InChI=1S/C11H14N2O6/c1-16-11(17-2)5-12-7-3-9-10(19-6-18-9)4-8(7)13(14)15/h3-4,11-12H,5-6H2,1-2H3 |
| InChIKey | RJQSEKIKTUZPIV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|