C12H8Br2N2O4S — CID 102832279
N-[(4,5-dibromothiophen-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine (PubChem CID 102832279) has the molecular formula C12H8Br2N2O4S and a molecular weight of 436.08 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 102832279 |
| Molecular Formula | C12H8Br2N2O4S |
| Molecular Weight | 436.08 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1NCc1cc(Br)c(Br)s1)OCO2 |
| InChI | InChI=1S/C12H8Br2N2O4S/c13-7-1-6(21-12(7)14)4-15-8-2-10-11(20-5-19-10)3-9(8)16(17)18/h1-3,15H,4-5H2 |
| InChIKey | CNNOTDVIFOKOMN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|