C11H8Br2N2O3S — CID 102834080
4-[(4,5-dibromothiophen-2-yl)methylamino]-3-nitrophenol (PubChem CID 102834080) has the molecular formula C11H8Br2N2O3S and a molecular weight of 408.07 g/mol. Its IUPAC name is 4-[(4,5-dibromothiophen-2-yl)methylamino]-3-nitrophenol.
| Compound Name | 4-[(4,5-dibromothiophen-2-yl)methylamino]-3-nitrophenol |
|---|---|
| PubChem CID | 102834080 |
| Molecular Formula | C11H8Br2N2O3S |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 405.86 |
| IUPAC Name | 4-[(4,5-dibromothiophen-2-yl)methylamino]-3-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(O)ccc1NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H8Br2N2O3S/c12-8-4-7(19-11(8)13)5-14-9-2-1-6(16)3-10(9)15(17)18/h1-4,14,16H,5H2 |
| InChIKey | PQSAHBCKOIYNDI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|