C13H11N3O5 — CID 46530969
4-[(2,4-dinitroanilino)methyl]phenol (PubChem CID 46530969) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 4-[(2,4-dinitroanilino)methyl]phenol.
| Compound Name | 4-[(2,4-dinitroanilino)methyl]phenol |
|---|---|
| PubChem CID | 46530969 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[(2,4-dinitroanilino)methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccc(O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N3O5/c17-11-4-1-9(2-5-11)8-14-12-6-3-10(15(18)19)7-13(12)16(20)21/h1-7,14,17H,8H2 |
| InChIKey | ZLNKLQVRGMNCSF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|